C12H15NO3 — CID 115062591
4-(3a,4,5,6,7,7a-hexahydro-[1,3]dioxolo[4,5-c]pyridin-2-yl)phenol (PubChem CID 115062591) has the molecular formula C12H15NO3 and a molecular weight of 221.26 g/mol. Its IUPAC name is 4-(3a,4,5,6,7,7a-hexahydro-[1,3]dioxolo[4,5-c]pyridin-2-yl)phenol.
| Compound Name | 4-(3a,4,5,6,7,7a-hexahydro-[1,3]dioxolo[4,5-c]pyridin-2-yl)phenol |
|---|---|
| PubChem CID | 115062591 |
| Molecular Formula | C12H15NO3 |
| Molecular Weight | 221.26 g/mol |
| Exact Mass | 221.11 |
| IUPAC Name | 4-(3a,4,5,6,7,7a-hexahydro-[1,3]dioxolo[4,5-c]pyridin-2-yl)phenol |
| SMILES | Oc1ccc(C2OC3CCNCC3O2)cc1 |
| InChI | InChI=1S/C12H15NO3/c14-9-3-1-8(2-4-9)12-15-10-5-6-13-7-11(10)16-12/h1-4,10-14H,5-7H2 |
| InChIKey | FPNXPJFZDHQNED-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 50.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.26 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |