C14H17ClN2O2 — CID 115064126
3-(3-chlorophenyl)-4-piperidin-4-yl-1,3-oxazolidin-2-one (PubChem CID 115064126) has the molecular formula C14H17ClN2O2 and a molecular weight of 280.75 g/mol. Its IUPAC name is 3-(3-chlorophenyl)-4-piperidin-4-yl-1,3-oxazolidin-2-one.
| Compound Name | 3-(3-chlorophenyl)-4-piperidin-4-yl-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 115064126 |
| Molecular Formula | C14H17ClN2O2 |
| Molecular Weight | 280.75 g/mol |
| Exact Mass | 280.10 |
| IUPAC Name | 3-(3-chlorophenyl)-4-piperidin-4-yl-1,3-oxazolidin-2-one |
| SMILES | O=C1OCC(C2CCNCC2)N1c1cccc(Cl)c1 |
| InChI | InChI=1S/C14H17ClN2O2/c15-11-2-1-3-12(8-11)17-13(9-19-14(17)18)10-4-6-16-7-5-10/h1-3,8,10,13,16H,4-7,9H2 |
| InChIKey | ATIBRWSEFWOPJP-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.75 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |