About 1,1-difluorobuta-1,3-diene
1,1-difluorobuta-1,3-diene (PubChem CID 11506444) has the molecular formula C4H4F2
and a molecular weight of 90.07 g/mol. Its IUPAC name is 1,1-difluorobuta-1,3-diene.
Molecular Properties
| Compound Name | 1,1-difluorobuta-1,3-diene |
| PubChem CID | 11506444 |
| Molecular Formula | C4H4F2 |
| Molecular Weight | 90.07 g/mol |
| Exact Mass | 90.03 |
| IUPAC Name | 1,1-difluorobuta-1,3-diene |
| SMILES | C=CC=C(F)F |
| InChI | InChI=1S/C4H4F2/c1-2-3-4(5)6/h2-3H,1H2 |
| InChIKey | XWOKUHDOBJAMAL-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 6 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 90.07 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 1,1-difluorobuta-1,3-diene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,1-difluorobuta-1,3-diene?
The IUPAC name of 1,1-difluorobuta-1,3-diene (CID 11506444) is 1,1-difluorobuta-1,3-diene.
What is the SMILES notation for 1,1-difluorobuta-1,3-diene?
The canonical SMILES for 1,1-difluorobuta-1,3-diene is C=CC=C(F)F.
What is the InChIKey of 1,1-difluorobuta-1,3-diene?
The InChIKey is XWOKUHDOBJAMAL-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H4F2/c1-2-3-4(5)6/h2-3H,1H2.
What are the key properties of 1,1-difluorobuta-1,3-diene?
1,1-difluorobuta-1,3-diene has a molecular weight of 90.07 g/mol, XLogP of 1.95, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1,1-difluorobuta-1,3-diene is sourced from PubChem (CID 11506444), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).