About 1-amino-3-(2,6-dimethylphenyl)urea
1-amino-3-(2,6-dimethylphenyl)urea (PubChem CID 11506553) has the molecular formula C9H13N3O
and a molecular weight of 179.22 g/mol. Its IUPAC name is 1-amino-3-(2,6-dimethylphenyl)urea.
Molecular Properties
| Compound Name | 1-amino-3-(2,6-dimethylphenyl)urea |
| PubChem CID | 11506553 |
| Molecular Formula | C9H13N3O |
| Molecular Weight | 179.22 g/mol |
| Exact Mass | 179.11 |
| IUPAC Name | 1-amino-3-(2,6-dimethylphenyl)urea |
| SMILES | Cc1cccc(C)c1NC(=O)NN |
| InChI | InChI=1S/C9H13N3O/c1-6-4-3-5-7(2)8(6)11-9(13)12-10/h3-5H,10H2,1-2H3,(H2,11,12,13) |
| InChIKey | LQBLFMCUKOQGSG-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 67.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 179.22 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-amino-3-(2,6-dimethylphenyl)urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-amino-3-(2,6-dimethylphenyl)urea?
The IUPAC name of 1-amino-3-(2,6-dimethylphenyl)urea (CID 11506553) is 1-amino-3-(2,6-dimethylphenyl)urea.
What is the SMILES notation for 1-amino-3-(2,6-dimethylphenyl)urea?
The canonical SMILES for 1-amino-3-(2,6-dimethylphenyl)urea is Cc1cccc(C)c1NC(=O)NN.
What is the InChIKey of 1-amino-3-(2,6-dimethylphenyl)urea?
The InChIKey is LQBLFMCUKOQGSG-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H13N3O/c1-6-4-3-5-7(2)8(6)11-9(13)12-10/h3-5H,10H2,1-2H3,(H2,11,12,13).
What are the key properties of 1-amino-3-(2,6-dimethylphenyl)urea?
1-amino-3-(2,6-dimethylphenyl)urea has a molecular weight of 179.22 g/mol, XLogP of 1.30, 1 rotatable bonds, 3 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-amino-3-(2,6-dimethylphenyl)urea is sourced from PubChem (CID 11506553), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).