About 3a,4,5,6,7,7a-hexahydro-1,3-benzoxazol-5-ylmethanamine
3a,4,5,6,7,7a-hexahydro-1,3-benzoxazol-5-ylmethanamine (PubChem CID 115065804) has the molecular formula C8H14N2O
and a molecular weight of 154.21 g/mol. Its IUPAC name is 3a,4,5,6,7,7a-hexahydro-1,3-benzoxazol-5-ylmethanamine.
Analyze 3a,4,5,6,7,7a-hexahydro-1,3-benzoxazol-5-ylmethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3a,4,5,6,7,7a-hexahydro-1,3-benzoxazol-5-ylmethanamine?
The IUPAC name of 3a,4,5,6,7,7a-hexahydro-1,3-benzoxazol-5-ylmethanamine (CID 115065804) is 3a,4,5,6,7,7a-hexahydro-1,3-benzoxazol-5-ylmethanamine.
What is the SMILES notation for 3a,4,5,6,7,7a-hexahydro-1,3-benzoxazol-5-ylmethanamine?
The canonical SMILES for 3a,4,5,6,7,7a-hexahydro-1,3-benzoxazol-5-ylmethanamine is NCC1CCC2OC=NC2C1.
What is the InChIKey of 3a,4,5,6,7,7a-hexahydro-1,3-benzoxazol-5-ylmethanamine?
The InChIKey is VJAMULALDQZGLQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H14N2O/c9-4-6-1-2-8-7(3-6)10-5-11-8/h5-8H,1-4,9H2.
What are the key properties of 3a,4,5,6,7,7a-hexahydro-1,3-benzoxazol-5-ylmethanamine?
3a,4,5,6,7,7a-hexahydro-1,3-benzoxazol-5-ylmethanamine has a molecular weight of 154.21 g/mol, XLogP of 0.54, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3a,4,5,6,7,7a-hexahydro-1,3-benzoxazol-5-ylmethanamine is sourced from PubChem (CID 115065804), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).