C10H18O3 — CID 11506581
3-[(4R,6R)-2,2,6-trimethyl-1,3-dioxan-4-yl]propanal (PubChem CID 11506581) has the molecular formula C10H18O3 and a molecular weight of 186.25 g/mol. Its IUPAC name is 3-[(4R,6R)-2,2,6-trimethyl-1,3-dioxan-4-yl]propanal.
| Compound Name | 3-[(4R,6R)-2,2,6-trimethyl-1,3-dioxan-4-yl]propanal |
|---|---|
| PubChem CID | 11506581 |
| Molecular Formula | C10H18O3 |
| Molecular Weight | 186.25 g/mol |
| Exact Mass | 186.13 |
| IUPAC Name | 3-[(4R,6R)-2,2,6-trimethyl-1,3-dioxan-4-yl]propanal |
| SMILES | C[C@@H]1C[C@@H](CCC=O)OC(C)(C)O1 |
| InChI | InChI=1S/C10H18O3/c1-8-7-9(5-4-6-11)13-10(2,3)12-8/h6,8-9H,4-5,7H2,1-3H3/t8-,9-/m1/s1 |
| InChIKey | POGPQQWICXTHOD-RKDXNWHRSA-N |
| XLogP | 1.90 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.25 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|