C16H19NO4 — CID 115065977
2-[(4-methoxyphenyl)methyl]-3a,4,5,6,7,7a-hexahydro-1,3-benzoxazole-5-carboxylic acid (PubChem CID 115065977) has the molecular formula C16H19NO4 and a molecular weight of 289.33 g/mol. Its IUPAC name is 2-[(4-methoxyphenyl)methyl]-3a,4,5,6,7,7a-hexahydro-1,3-benzoxazole-5-carboxylic acid.
| Compound Name | 2-[(4-methoxyphenyl)methyl]-3a,4,5,6,7,7a-hexahydro-1,3-benzoxazole-5-carboxylic acid |
|---|---|
| PubChem CID | 115065977 |
| Molecular Formula | C16H19NO4 |
| Molecular Weight | 289.33 g/mol |
| Exact Mass | 289.13 |
| IUPAC Name | 2-[(4-methoxyphenyl)methyl]-3a,4,5,6,7,7a-hexahydro-1,3-benzoxazole-5-carboxylic acid |
| SMILES | COc1ccc(CC2=NC3CC(C(=O)O)CCC3O2)cc1 |
| InChI | InChI=1S/C16H19NO4/c1-20-12-5-2-10(3-6-12)8-15-17-13-9-11(16(18)19)4-7-14(13)21-15/h2-3,5-6,11,13-14H,4,7-9H2,1H3,(H,18,19) |
| InChIKey | PQOICBSLRAXDAG-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 68.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.33 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |