C13H19NO3 — CID 115066270
2-cyclopentyl-3a,4,5,6,7,7a-hexahydro-1,3-benzoxazole-6-carboxylic acid (PubChem CID 115066270) has the molecular formula C13H19NO3 and a molecular weight of 237.30 g/mol. Its IUPAC name is 2-cyclopentyl-3a,4,5,6,7,7a-hexahydro-1,3-benzoxazole-6-carboxylic acid.
| Compound Name | 2-cyclopentyl-3a,4,5,6,7,7a-hexahydro-1,3-benzoxazole-6-carboxylic acid |
|---|---|
| PubChem CID | 115066270 |
| Molecular Formula | C13H19NO3 |
| Molecular Weight | 237.30 g/mol |
| Exact Mass | 237.14 |
| IUPAC Name | 2-cyclopentyl-3a,4,5,6,7,7a-hexahydro-1,3-benzoxazole-6-carboxylic acid |
| SMILES | O=C(O)C1CCC2N=C(C3CCCC3)OC2C1 |
| InChI | InChI=1S/C13H19NO3/c15-13(16)9-5-6-10-11(7-9)17-12(14-10)8-3-1-2-4-8/h8-11H,1-7H2,(H,15,16) |
| InChIKey | NLALGSCWNHLUOS-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 58.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.30 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |