C15H20N2O2 — CID 115066458
4-[[6-(aminomethyl)-3a,4,5,6,7,7a-hexahydro-1,3-benzoxazol-2-yl]methyl]phenol (PubChem CID 115066458) has the molecular formula C15H20N2O2 and a molecular weight of 260.34 g/mol. Its IUPAC name is 4-[[6-(aminomethyl)-3a,4,5,6,7,7a-hexahydro-1,3-benzoxazol-2-yl]methyl]phenol.
| Compound Name | 4-[[6-(aminomethyl)-3a,4,5,6,7,7a-hexahydro-1,3-benzoxazol-2-yl]methyl]phenol |
|---|---|
| PubChem CID | 115066458 |
| Molecular Formula | C15H20N2O2 |
| Molecular Weight | 260.34 g/mol |
| Exact Mass | 260.15 |
| IUPAC Name | 4-[[6-(aminomethyl)-3a,4,5,6,7,7a-hexahydro-1,3-benzoxazol-2-yl]methyl]phenol |
| SMILES | NCC1CCC2N=C(Cc3ccc(O)cc3)OC2C1 |
| InChI | InChI=1S/C15H20N2O2/c16-9-11-3-6-13-14(7-11)19-15(17-13)8-10-1-4-12(18)5-2-10/h1-2,4-5,11,13-14,18H,3,6-9,16H2 |
| InChIKey | XHOQFMUPJOFOGO-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 67.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.34 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |