C15H17F3N2S — CID 115066673
[2-[3-(trifluoromethyl)phenyl]-3a,4,5,6,7,7a-hexahydro-1,3-benzothiazol-6-yl]methanamine (PubChem CID 115066673) has the molecular formula C15H17F3N2S and a molecular weight of 314.38 g/mol. Its IUPAC name is [2-[3-(trifluoromethyl)phenyl]-3a,4,5,6,7,7a-hexahydro-1,3-benzothiazol-6-yl]methanamine.
| Compound Name | [2-[3-(trifluoromethyl)phenyl]-3a,4,5,6,7,7a-hexahydro-1,3-benzothiazol-6-yl]methanamine |
|---|---|
| PubChem CID | 115066673 |
| Molecular Formula | C15H17F3N2S |
| Molecular Weight | 314.38 g/mol |
| Exact Mass | 314.11 |
| IUPAC Name | [2-[3-(trifluoromethyl)phenyl]-3a,4,5,6,7,7a-hexahydro-1,3-benzothiazol-6-yl]methanamine |
| SMILES | NCC1CCC2N=C(c3cccc(C(F)(F)F)c3)SC2C1 |
| InChI | InChI=1S/C15H17F3N2S/c16-15(17,18)11-3-1-2-10(7-11)14-20-12-5-4-9(8-19)6-13(12)21-14/h1-3,7,9,12-13H,4-6,8,19H2 |
| InChIKey | LMFTYHNQTOPNRA-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.38 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |