About 4,5-dichloro-7H-pyrrolo[2,3-d]pyrimidin-2-amine
4,5-dichloro-7H-pyrrolo[2,3-d]pyrimidin-2-amine (PubChem CID 11506669) has the molecular formula C6H4Cl2N4
and a molecular weight of 203.03 g/mol. Its IUPAC name is 4,5-dichloro-7H-pyrrolo[2,3-d]pyrimidin-2-amine.
Molecular Properties
| Compound Name | 4,5-dichloro-7H-pyrrolo[2,3-d]pyrimidin-2-amine |
| PubChem CID | 11506669 |
| Molecular Formula | C6H4Cl2N4 |
| Molecular Weight | 203.03 g/mol |
| Exact Mass | 201.98 |
| IUPAC Name | 4,5-dichloro-7H-pyrrolo[2,3-d]pyrimidin-2-amine |
| SMILES | Nc1nc(Cl)c2c(Cl)c[nH]c2n1 |
| InChI | InChI=1S/C6H4Cl2N4/c7-2-1-10-5-3(2)4(8)11-6(9)12-5/h1H,(H3,9,10,11,12) |
| InChIKey | PCVVGPYKRWHBKE-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 67.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 203.03 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4,5-dichloro-7H-pyrrolo[2,3-d]pyrimidin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,5-dichloro-7H-pyrrolo[2,3-d]pyrimidin-2-amine?
The IUPAC name of 4,5-dichloro-7H-pyrrolo[2,3-d]pyrimidin-2-amine (CID 11506669) is 4,5-dichloro-7H-pyrrolo[2,3-d]pyrimidin-2-amine.
What is the SMILES notation for 4,5-dichloro-7H-pyrrolo[2,3-d]pyrimidin-2-amine?
The canonical SMILES for 4,5-dichloro-7H-pyrrolo[2,3-d]pyrimidin-2-amine is Nc1nc(Cl)c2c(Cl)c[nH]c2n1.
What is the InChIKey of 4,5-dichloro-7H-pyrrolo[2,3-d]pyrimidin-2-amine?
The InChIKey is PCVVGPYKRWHBKE-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H4Cl2N4/c7-2-1-10-5-3(2)4(8)11-6(9)12-5/h1H,(H3,9,10,11,12).
What are the key properties of 4,5-dichloro-7H-pyrrolo[2,3-d]pyrimidin-2-amine?
4,5-dichloro-7H-pyrrolo[2,3-d]pyrimidin-2-amine has a molecular weight of 203.03 g/mol, XLogP of 1.85, 0 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4,5-dichloro-7H-pyrrolo[2,3-d]pyrimidin-2-amine is sourced from PubChem (CID 11506669), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).