C13H14FNOS — CID 115066721
2-(4-fluorophenyl)-3a,4,5,6,7,7a-hexahydro-1,3-benzothiazol-6-ol (PubChem CID 115066721) has the molecular formula C13H14FNOS and a molecular weight of 251.33 g/mol. Its IUPAC name is 2-(4-fluorophenyl)-3a,4,5,6,7,7a-hexahydro-1,3-benzothiazol-6-ol.
| Compound Name | 2-(4-fluorophenyl)-3a,4,5,6,7,7a-hexahydro-1,3-benzothiazol-6-ol |
|---|---|
| PubChem CID | 115066721 |
| Molecular Formula | C13H14FNOS |
| Molecular Weight | 251.33 g/mol |
| Exact Mass | 251.08 |
| IUPAC Name | 2-(4-fluorophenyl)-3a,4,5,6,7,7a-hexahydro-1,3-benzothiazol-6-ol |
| SMILES | OC1CCC2N=C(c3ccc(F)cc3)SC2C1 |
| InChI | InChI=1S/C13H14FNOS/c14-9-3-1-8(2-4-9)13-15-11-6-5-10(16)7-12(11)17-13/h1-4,10-12,16H,5-7H2 |
| InChIKey | RKRHABUUDYWXNI-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 32.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.33 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |