C14H17FN2S — CID 115066728
[2-(4-fluorophenyl)-3a,4,5,6,7,7a-hexahydro-1,3-benzothiazol-6-yl]methanamine (PubChem CID 115066728) has the molecular formula C14H17FN2S and a molecular weight of 264.37 g/mol. Its IUPAC name is [2-(4-fluorophenyl)-3a,4,5,6,7,7a-hexahydro-1,3-benzothiazol-6-yl]methanamine.
| Compound Name | [2-(4-fluorophenyl)-3a,4,5,6,7,7a-hexahydro-1,3-benzothiazol-6-yl]methanamine |
|---|---|
| PubChem CID | 115066728 |
| Molecular Formula | C14H17FN2S |
| Molecular Weight | 264.37 g/mol |
| Exact Mass | 264.11 |
| IUPAC Name | [2-(4-fluorophenyl)-3a,4,5,6,7,7a-hexahydro-1,3-benzothiazol-6-yl]methanamine |
| SMILES | NCC1CCC2N=C(c3ccc(F)cc3)SC2C1 |
| InChI | InChI=1S/C14H17FN2S/c15-11-4-2-10(3-5-11)14-17-12-6-1-9(8-16)7-13(12)18-14/h2-5,9,12-13H,1,6-8,16H2 |
| InChIKey | GHDHOUGJCPCCMZ-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.37 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |