C14H15F3N2S — CID 115066737
2-[4-(trifluoromethyl)phenyl]-3a,4,5,6,7,7a-hexahydro-1,3-benzothiazol-6-amine (PubChem CID 115066737) has the molecular formula C14H15F3N2S and a molecular weight of 300.35 g/mol. Its IUPAC name is 2-[4-(trifluoromethyl)phenyl]-3a,4,5,6,7,7a-hexahydro-1,3-benzothiazol-6-amine.
| Compound Name | 2-[4-(trifluoromethyl)phenyl]-3a,4,5,6,7,7a-hexahydro-1,3-benzothiazol-6-amine |
|---|---|
| PubChem CID | 115066737 |
| Molecular Formula | C14H15F3N2S |
| Molecular Weight | 300.35 g/mol |
| Exact Mass | 300.09 |
| IUPAC Name | 2-[4-(trifluoromethyl)phenyl]-3a,4,5,6,7,7a-hexahydro-1,3-benzothiazol-6-amine |
| SMILES | NC1CCC2N=C(c3ccc(C(F)(F)F)cc3)SC2C1 |
| InChI | InChI=1S/C14H15F3N2S/c15-14(16,17)9-3-1-8(2-4-9)13-19-11-6-5-10(18)7-12(11)20-13/h1-4,10-12H,5-7,18H2 |
| InChIKey | JJQYNBHEJUQPAC-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.35 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |