C16H22N2OS — CID 115066779
[2-[(3-methoxyphenyl)methyl]-3a,4,5,6,7,7a-hexahydro-1,3-benzothiazol-6-yl]methanamine (PubChem CID 115066779) has the molecular formula C16H22N2OS and a molecular weight of 290.43 g/mol. Its IUPAC name is [2-[(3-methoxyphenyl)methyl]-3a,4,5,6,7,7a-hexahydro-1,3-benzothiazol-6-yl]methanamine.
| Compound Name | [2-[(3-methoxyphenyl)methyl]-3a,4,5,6,7,7a-hexahydro-1,3-benzothiazol-6-yl]methanamine |
|---|---|
| PubChem CID | 115066779 |
| Molecular Formula | C16H22N2OS |
| Molecular Weight | 290.43 g/mol |
| Exact Mass | 290.15 |
| IUPAC Name | [2-[(3-methoxyphenyl)methyl]-3a,4,5,6,7,7a-hexahydro-1,3-benzothiazol-6-yl]methanamine |
| SMILES | COc1cccc(CC2=NC3CCC(CN)CC3S2)c1 |
| InChI | InChI=1S/C16H22N2OS/c1-19-13-4-2-3-11(7-13)9-16-18-14-6-5-12(10-17)8-15(14)20-16/h2-4,7,12,14-15H,5-6,8-10,17H2,1H3 |
| InChIKey | XLVWGBALVMDKJR-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 47.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.43 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |