C11H17NOS — CID 115066885
2-tert-butyl-4,5,6,7-tetrahydro-1,3-benzothiazol-6-ol (PubChem CID 115066885) has the molecular formula C11H17NOS and a molecular weight of 211.33 g/mol. Its IUPAC name is 2-tert-butyl-4,5,6,7-tetrahydro-1,3-benzothiazol-6-ol.
| Compound Name | 2-tert-butyl-4,5,6,7-tetrahydro-1,3-benzothiazol-6-ol |
|---|---|
| PubChem CID | 115066885 |
| Molecular Formula | C11H17NOS |
| Molecular Weight | 211.33 g/mol |
| Exact Mass | 211.10 |
| IUPAC Name | 2-tert-butyl-4,5,6,7-tetrahydro-1,3-benzothiazol-6-ol |
| SMILES | CC(C)(C)c1nc2c(s1)CC(O)CC2 |
| InChI | InChI=1S/C11H17NOS/c1-11(2,3)10-12-8-5-4-7(13)6-9(8)14-10/h7,13H,4-6H2,1-3H3 |
| InChIKey | BXNGCUDOXGOEQP-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.33 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |