About 1-[(3R)-1,4-dioxaspiro[4.5]decan-3-yl]propane-1,2-dione
1-[(3R)-1,4-dioxaspiro[4.5]decan-3-yl]propane-1,2-dione (PubChem CID 11506735) has the molecular formula C11H16O4
and a molecular weight of 212.24 g/mol. Its IUPAC name is 1-[(3R)-1,4-dioxaspiro[4.5]decan-3-yl]propane-1,2-dione.
Molecular Properties
| Compound Name | 1-[(3R)-1,4-dioxaspiro[4.5]decan-3-yl]propane-1,2-dione |
| PubChem CID | 11506735 |
| Molecular Formula | C11H16O4 |
| Molecular Weight | 212.24 g/mol |
| Exact Mass | 212.10 |
| IUPAC Name | 1-[(3R)-1,4-dioxaspiro[4.5]decan-3-yl]propane-1,2-dione |
| SMILES | CC(=O)C(=O)[C@H]1COC2(CCCCC2)O1 |
| InChI | InChI=1S/C11H16O4/c1-8(12)10(13)9-7-14-11(15-9)5-3-2-4-6-11/h9H,2-7H2,1H3/t9-/m1/s1 |
| InChIKey | OHQIVKZQGGEQDZ-SECBINFHSA-N |
| XLogP | 1.22 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 212.24 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze 1-[(3R)-1,4-dioxaspiro[4.5]decan-3-yl]propane-1,2-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(3R)-1,4-dioxaspiro[4.5]decan-3-yl]propane-1,2-dione?
The IUPAC name of 1-[(3R)-1,4-dioxaspiro[4.5]decan-3-yl]propane-1,2-dione (CID 11506735) is 1-[(3R)-1,4-dioxaspiro[4.5]decan-3-yl]propane-1,2-dione.
What is the SMILES notation for 1-[(3R)-1,4-dioxaspiro[4.5]decan-3-yl]propane-1,2-dione?
The canonical SMILES for 1-[(3R)-1,4-dioxaspiro[4.5]decan-3-yl]propane-1,2-dione is CC(=O)C(=O)[C@H]1COC2(CCCCC2)O1.
What is the InChIKey of 1-[(3R)-1,4-dioxaspiro[4.5]decan-3-yl]propane-1,2-dione?
The InChIKey is OHQIVKZQGGEQDZ-SECBINFHSA-N. The full InChI is InChI=1S/C11H16O4/c1-8(12)10(13)9-7-14-11(15-9)5-3-2-4-6-11/h9H,2-7H2,1H3/t9-/m1/s1.
What are the key properties of 1-[(3R)-1,4-dioxaspiro[4.5]decan-3-yl]propane-1,2-dione?
1-[(3R)-1,4-dioxaspiro[4.5]decan-3-yl]propane-1,2-dione has a molecular weight of 212.24 g/mol, XLogP of 1.22, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(3R)-1,4-dioxaspiro[4.5]decan-3-yl]propane-1,2-dione is sourced from PubChem (CID 11506735), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).