About 4-ethyl-1-oxa-4,10-diazaspiro[5.6]dodecan-3-one
4-ethyl-1-oxa-4,10-diazaspiro[5.6]dodecan-3-one (PubChem CID 115067508) has the molecular formula C11H20N2O2
and a molecular weight of 212.29 g/mol. Its IUPAC name is 4-ethyl-1-oxa-4,10-diazaspiro[5.6]dodecan-3-one.
Molecular Properties
| Compound Name | 4-ethyl-1-oxa-4,10-diazaspiro[5.6]dodecan-3-one |
| PubChem CID | 115067508 |
| Molecular Formula | C11H20N2O2 |
| Molecular Weight | 212.29 g/mol |
| Exact Mass | 212.15 |
| IUPAC Name | 4-ethyl-1-oxa-4,10-diazaspiro[5.6]dodecan-3-one |
| SMILES | CCN1CC2(CCCNCC2)OCC1=O |
| InChI | InChI=1S/C11H20N2O2/c1-2-13-9-11(15-8-10(13)14)4-3-6-12-7-5-11/h12H,2-9H2,1H3 |
| InChIKey | LKLHJZGJYMOODJ-UHFFFAOYSA-N |
| XLogP | 0.38 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 212.29 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-ethyl-1-oxa-4,10-diazaspiro[5.6]dodecan-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-ethyl-1-oxa-4,10-diazaspiro[5.6]dodecan-3-one?
The IUPAC name of 4-ethyl-1-oxa-4,10-diazaspiro[5.6]dodecan-3-one (CID 115067508) is 4-ethyl-1-oxa-4,10-diazaspiro[5.6]dodecan-3-one.
What is the SMILES notation for 4-ethyl-1-oxa-4,10-diazaspiro[5.6]dodecan-3-one?
The canonical SMILES for 4-ethyl-1-oxa-4,10-diazaspiro[5.6]dodecan-3-one is CCN1CC2(CCCNCC2)OCC1=O.
What is the InChIKey of 4-ethyl-1-oxa-4,10-diazaspiro[5.6]dodecan-3-one?
The InChIKey is LKLHJZGJYMOODJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H20N2O2/c1-2-13-9-11(15-8-10(13)14)4-3-6-12-7-5-11/h12H,2-9H2,1H3.
What are the key properties of 4-ethyl-1-oxa-4,10-diazaspiro[5.6]dodecan-3-one?
4-ethyl-1-oxa-4,10-diazaspiro[5.6]dodecan-3-one has a molecular weight of 212.29 g/mol, XLogP of 0.38, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-ethyl-1-oxa-4,10-diazaspiro[5.6]dodecan-3-one is sourced from PubChem (CID 115067508), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).