About 1-pyrrolidin-3-ylpyrimidine-2,4-dione
1-pyrrolidin-3-ylpyrimidine-2,4-dione (PubChem CID 11506781) has the molecular formula C8H11N3O2
and a molecular weight of 181.19 g/mol. Its IUPAC name is 1-pyrrolidin-3-ylpyrimidine-2,4-dione.
Molecular Properties
| Compound Name | 1-pyrrolidin-3-ylpyrimidine-2,4-dione |
| PubChem CID | 11506781 |
| Molecular Formula | C8H11N3O2 |
| Molecular Weight | 181.19 g/mol |
| Exact Mass | 181.09 |
| IUPAC Name | 1-pyrrolidin-3-ylpyrimidine-2,4-dione |
| SMILES | O=c1ccn(C2CCNC2)c(=O)[nH]1 |
| InChI | InChI=1S/C8H11N3O2/c12-7-2-4-11(8(13)10-7)6-1-3-9-5-6/h2,4,6,9H,1,3,5H2,(H,10,12,13) |
| InChIKey | MSFBOFSKTWCBIY-UHFFFAOYSA-N |
| XLogP | -0.93 |
| TPSA | 66.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 181.19 |
| LogP ≤ 5 | -0.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-pyrrolidin-3-ylpyrimidine-2,4-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-pyrrolidin-3-ylpyrimidine-2,4-dione?
The IUPAC name of 1-pyrrolidin-3-ylpyrimidine-2,4-dione (CID 11506781) is 1-pyrrolidin-3-ylpyrimidine-2,4-dione.
What is the SMILES notation for 1-pyrrolidin-3-ylpyrimidine-2,4-dione?
The canonical SMILES for 1-pyrrolidin-3-ylpyrimidine-2,4-dione is O=c1ccn(C2CCNC2)c(=O)[nH]1.
What is the InChIKey of 1-pyrrolidin-3-ylpyrimidine-2,4-dione?
The InChIKey is MSFBOFSKTWCBIY-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H11N3O2/c12-7-2-4-11(8(13)10-7)6-1-3-9-5-6/h2,4,6,9H,1,3,5H2,(H,10,12,13).
What are the key properties of 1-pyrrolidin-3-ylpyrimidine-2,4-dione?
1-pyrrolidin-3-ylpyrimidine-2,4-dione has a molecular weight of 181.19 g/mol, XLogP of -0.93, 1 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-pyrrolidin-3-ylpyrimidine-2,4-dione is sourced from PubChem (CID 11506781), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).