About N-benzyl-3-chloroaniline
N-benzyl-3-chloroaniline (PubChem CID 11506782) has the molecular formula C13H12ClN
and a molecular weight of 217.70 g/mol. Its IUPAC name is N-benzyl-3-chloroaniline.
Molecular Properties
| Compound Name | N-benzyl-3-chloroaniline |
| PubChem CID | 11506782 |
| Molecular Formula | C13H12ClN |
| Molecular Weight | 217.70 g/mol |
| Exact Mass | 217.07 |
| IUPAC Name | N-benzyl-3-chloroaniline |
| SMILES | Clc1cccc(NCc2ccccc2)c1 |
| InChI | InChI=1S/C13H12ClN/c14-12-7-4-8-13(9-12)15-10-11-5-2-1-3-6-11/h1-9,15H,10H2 |
| InChIKey | NQIJQQDDQDHYJK-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 217.70 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze N-benzyl-3-chloroaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-benzyl-3-chloroaniline?
The IUPAC name of N-benzyl-3-chloroaniline (CID 11506782) is N-benzyl-3-chloroaniline.
What is the SMILES notation for N-benzyl-3-chloroaniline?
The canonical SMILES for N-benzyl-3-chloroaniline is Clc1cccc(NCc2ccccc2)c1.
What is the InChIKey of N-benzyl-3-chloroaniline?
The InChIKey is NQIJQQDDQDHYJK-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H12ClN/c14-12-7-4-8-13(9-12)15-10-11-5-2-1-3-6-11/h1-9,15H,10H2.
What are the key properties of N-benzyl-3-chloroaniline?
N-benzyl-3-chloroaniline has a molecular weight of 217.70 g/mol, XLogP of 3.95, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-benzyl-3-chloroaniline is sourced from PubChem (CID 11506782), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).