About (8-fluoro-4H-thieno[3,2-c]chromen-2-yl)methanol
(8-fluoro-4H-thieno[3,2-c]chromen-2-yl)methanol (PubChem CID 11506936) has the molecular formula C12H9FO2S
and a molecular weight of 236.27 g/mol. Its IUPAC name is (8-fluoro-4H-thieno[3,2-c]chromen-2-yl)methanol.
Molecular Properties
| Compound Name | (8-fluoro-4H-thieno[3,2-c]chromen-2-yl)methanol |
| PubChem CID | 11506936 |
| Molecular Formula | C12H9FO2S |
| Molecular Weight | 236.27 g/mol |
| Exact Mass | 236.03 |
| IUPAC Name | (8-fluoro-4H-thieno[3,2-c]chromen-2-yl)methanol |
| SMILES | OCc1cc2c(s1)-c1cc(F)ccc1OC2 |
| InChI | InChI=1S/C12H9FO2S/c13-8-1-2-11-10(4-8)12-7(6-15-11)3-9(5-14)16-12/h1-4,14H,5-6H2 |
| InChIKey | HHIAEQVRXAJIKQ-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 236.27 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (8-fluoro-4H-thieno[3,2-c]chromen-2-yl)methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (8-fluoro-4H-thieno[3,2-c]chromen-2-yl)methanol?
The IUPAC name of (8-fluoro-4H-thieno[3,2-c]chromen-2-yl)methanol (CID 11506936) is (8-fluoro-4H-thieno[3,2-c]chromen-2-yl)methanol.
What is the SMILES notation for (8-fluoro-4H-thieno[3,2-c]chromen-2-yl)methanol?
The canonical SMILES for (8-fluoro-4H-thieno[3,2-c]chromen-2-yl)methanol is OCc1cc2c(s1)-c1cc(F)ccc1OC2.
What is the InChIKey of (8-fluoro-4H-thieno[3,2-c]chromen-2-yl)methanol?
The InChIKey is HHIAEQVRXAJIKQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H9FO2S/c13-8-1-2-11-10(4-8)12-7(6-15-11)3-9(5-14)16-12/h1-4,14H,5-6H2.
What are the key properties of (8-fluoro-4H-thieno[3,2-c]chromen-2-yl)methanol?
(8-fluoro-4H-thieno[3,2-c]chromen-2-yl)methanol has a molecular weight of 236.27 g/mol, XLogP of 2.94, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (8-fluoro-4H-thieno[3,2-c]chromen-2-yl)methanol is sourced from PubChem (CID 11506936), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).