C13H18O4 — CID 11506958
(1R,5R)-7,7-bis(ethenyl)-5-(hydroxymethyl)-6-oxabicyclo[3.2.1]octane-1-carboxylic acid (PubChem CID 11506958) has the molecular formula C13H18O4 and a molecular weight of 238.28 g/mol. Its IUPAC name is (1R,5R)-7,7-bis(ethenyl)-5-(hydroxymethyl)-6-oxabicyclo[3.2.1]octane-1-carboxylic acid.
| Compound Name | (1R,5R)-7,7-bis(ethenyl)-5-(hydroxymethyl)-6-oxabicyclo[3.2.1]octane-1-carboxylic acid |
|---|---|
| PubChem CID | 11506958 |
| Molecular Formula | C13H18O4 |
| Molecular Weight | 238.28 g/mol |
| Exact Mass | 238.12 |
| IUPAC Name | (1R,5R)-7,7-bis(ethenyl)-5-(hydroxymethyl)-6-oxabicyclo[3.2.1]octane-1-carboxylic acid |
| SMILES | C=CC1(C=C)O[C@]2(CO)CCC[C@@]1(C(=O)O)C2 |
| InChI | InChI=1S/C13H18O4/c1-3-13(4-2)12(10(15)16)7-5-6-11(8-12,9-14)17-13/h3-4,14H,1-2,5-9H2,(H,15,16)/t11-,12+/m1/s1 |
| InChIKey | HWZQREDUZNMEFG-NEPJUHHUSA-N |
| XLogP | 1.50 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.28 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|