C13H12F3N3O2 — CID 115069639
2-[5-amino-1-[[2-(trifluoromethyl)phenyl]methyl]pyrazol-4-yl]acetic acid (PubChem CID 115069639) has the molecular formula C13H12F3N3O2 and a molecular weight of 299.25 g/mol. Its IUPAC name is 2-[5-amino-1-[[2-(trifluoromethyl)phenyl]methyl]pyrazol-4-yl]acetic acid.
| Compound Name | 2-[5-amino-1-[[2-(trifluoromethyl)phenyl]methyl]pyrazol-4-yl]acetic acid |
|---|---|
| PubChem CID | 115069639 |
| Molecular Formula | C13H12F3N3O2 |
| Molecular Weight | 299.25 g/mol |
| Exact Mass | 299.09 |
| IUPAC Name | 2-[5-amino-1-[[2-(trifluoromethyl)phenyl]methyl]pyrazol-4-yl]acetic acid |
| SMILES | Nc1c(CC(=O)O)cnn1Cc1ccccc1C(F)(F)F |
| InChI | InChI=1S/C13H12F3N3O2/c14-13(15,16)10-4-2-1-3-8(10)7-19-12(17)9(6-18-19)5-11(20)21/h1-4,6H,5,7,17H2,(H,20,21) |
| InChIKey | DXEMWVAPAVHKIV-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 81.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.25 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |