About 5-(3-aminopropyl)-4,6-dimethyl-1H-pyrimidine-2-thione
5-(3-aminopropyl)-4,6-dimethyl-1H-pyrimidine-2-thione (PubChem CID 115070125) has the molecular formula C9H15N3S
and a molecular weight of 197.31 g/mol. Its IUPAC name is 5-(3-aminopropyl)-4,6-dimethyl-1H-pyrimidine-2-thione.
Molecular Properties
| Compound Name | 5-(3-aminopropyl)-4,6-dimethyl-1H-pyrimidine-2-thione |
| PubChem CID | 115070125 |
| Molecular Formula | C9H15N3S |
| Molecular Weight | 197.31 g/mol |
| Exact Mass | 197.10 |
| IUPAC Name | 5-(3-aminopropyl)-4,6-dimethyl-1H-pyrimidine-2-thione |
| SMILES | Cc1nc(=S)[nH]c(C)c1CCCN |
| InChI | InChI=1S/C9H15N3S/c1-6-8(4-3-5-10)7(2)12-9(13)11-6/h3-5,10H2,1-2H3,(H,11,12,13) |
| InChIKey | MVGDKOKJXJAURG-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 54.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 197.31 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 5-(3-aminopropyl)-4,6-dimethyl-1H-pyrimidine-2-thione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(3-aminopropyl)-4,6-dimethyl-1H-pyrimidine-2-thione?
The IUPAC name of 5-(3-aminopropyl)-4,6-dimethyl-1H-pyrimidine-2-thione (CID 115070125) is 5-(3-aminopropyl)-4,6-dimethyl-1H-pyrimidine-2-thione.
What is the SMILES notation for 5-(3-aminopropyl)-4,6-dimethyl-1H-pyrimidine-2-thione?
The canonical SMILES for 5-(3-aminopropyl)-4,6-dimethyl-1H-pyrimidine-2-thione is Cc1nc(=S)[nH]c(C)c1CCCN.
What is the InChIKey of 5-(3-aminopropyl)-4,6-dimethyl-1H-pyrimidine-2-thione?
The InChIKey is MVGDKOKJXJAURG-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H15N3S/c1-6-8(4-3-5-10)7(2)12-9(13)11-6/h3-5,10H2,1-2H3,(H,11,12,13).
What are the key properties of 5-(3-aminopropyl)-4,6-dimethyl-1H-pyrimidine-2-thione?
5-(3-aminopropyl)-4,6-dimethyl-1H-pyrimidine-2-thione has a molecular weight of 197.31 g/mol, XLogP of 1.65, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(3-aminopropyl)-4,6-dimethyl-1H-pyrimidine-2-thione is sourced from PubChem (CID 115070125), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).