C15H20N2O2 — CID 11507187
(1S,9aR)-1-[(2-oxo-1-pyridinyl)methyl]-1,2,3,6,7,8,9,9a-octahydroquinolizin-4-one (PubChem CID 11507187) has the molecular formula C15H20N2O2 and a molecular weight of 260.34 g/mol. Its IUPAC name is (1S,9aR)-1-[(2-oxo-1-pyridinyl)methyl]-1,2,3,6,7,8,9,9a-octahydroquinolizin-4-one.
| Compound Name | (1S,9aR)-1-[(2-oxo-1-pyridinyl)methyl]-1,2,3,6,7,8,9,9a-octahydroquinolizin-4-one |
|---|---|
| PubChem CID | 11507187 |
| Molecular Formula | C15H20N2O2 |
| Molecular Weight | 260.34 g/mol |
| Exact Mass | 260.15 |
| IUPAC Name | (1S,9aR)-1-[(2-oxo-1-pyridinyl)methyl]-1,2,3,6,7,8,9,9a-octahydroquinolizin-4-one |
| SMILES | O=C1CC[C@@H](Cn2ccccc2=O)[C@H]2CCCCN12 |
| InChI | InChI=1S/C15H20N2O2/c18-14-6-2-3-9-16(14)11-12-7-8-15(19)17-10-4-1-5-13(12)17/h2-3,6,9,12-13H,1,4-5,7-8,10-11H2/t12-,13+/m0/s1 |
| InChIKey | NLFQTHGKFQQBSP-QWHCGFSZSA-N |
| XLogP | 1.64 |
| TPSA | 42.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.34 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |