C18H18N2 — CID 11507217
4-[(1E,3E,5E)-6-(4-aminophenyl)hexa-1,3,5-trienyl]aniline (PubChem CID 11507217) has the molecular formula C18H18N2 and a molecular weight of 262.36 g/mol. Its IUPAC name is 4-[(1E,3E,5E)-6-(4-aminophenyl)hexa-1,3,5-trienyl]aniline.
| Compound Name | 4-[(1E,3E,5E)-6-(4-aminophenyl)hexa-1,3,5-trienyl]aniline |
|---|---|
| PubChem CID | 11507217 |
| Molecular Formula | C18H18N2 |
| Molecular Weight | 262.36 g/mol |
| Exact Mass | 262.15 |
| IUPAC Name | 4-[(1E,3E,5E)-6-(4-aminophenyl)hexa-1,3,5-trienyl]aniline |
| SMILES | Nc1ccc(/C=C/C=C/C=C/c2ccc(N)cc2)cc1 |
| InChI | InChI=1S/C18H18N2/c19-17-11-7-15(8-12-17)5-3-1-2-4-6-16-9-13-18(20)14-10-16/h1-14H,19-20H2/b2-1+,5-3+,6-4+ |
| InChIKey | IZOOKGZEMKOBQA-CRQXNEITSA-N |
| XLogP | 4.13 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.36 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|