C11H20O7 — CID 11507236
(2R,3S,4S,5R,6R)-2-(hydroxymethyl)-6-[(E)-4-hydroxy-3-methylbut-2-enoxy]oxane-3,4,5-triol (PubChem CID 11507236) has the molecular formula C11H20O7 and a molecular weight of 264.27 g/mol. Its IUPAC name is (2R,3S,4S,5R,6R)-2-(hydroxymethyl)-6-[(E)-4-hydroxy-3-methylbut-2-enoxy]oxane-3,4,5-triol.
| Compound Name | (2R,3S,4S,5R,6R)-2-(hydroxymethyl)-6-[(E)-4-hydroxy-3-methylbut-2-enoxy]oxane-3,4,5-triol |
|---|---|
| PubChem CID | 11507236 |
| Molecular Formula | C11H20O7 |
| Molecular Weight | 264.27 g/mol |
| Exact Mass | 264.12 |
| IUPAC Name | (2R,3S,4S,5R,6R)-2-(hydroxymethyl)-6-[(E)-4-hydroxy-3-methylbut-2-enoxy]oxane-3,4,5-triol |
| SMILES | C/C(=C\CO[C@@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O)CO |
| InChI | InChI=1S/C11H20O7/c1-6(4-12)2-3-17-11-10(16)9(15)8(14)7(5-13)18-11/h2,7-16H,3-5H2,1H3/b6-2+/t7-,8-,9+,10-,11-/m1/s1 |
| InChIKey | MTNPSFBFGZMJPZ-ZCIPGPJXSA-N |
| XLogP | -2.26 |
| TPSA | 119.61 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.27 |
| LogP ≤ 5 | -2.26 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|