C14H14O3S — CID 115072814
ethyl 2-(3,7-dimethyl-1-benzothiophen-2-yl)-2-oxoacetate (PubChem CID 115072814) has the molecular formula C14H14O3S and a molecular weight of 262.33 g/mol. Its IUPAC name is ethyl 2-(3,7-dimethyl-1-benzothiophen-2-yl)-2-oxoacetate.
| Compound Name | ethyl 2-(3,7-dimethyl-1-benzothiophen-2-yl)-2-oxoacetate |
|---|---|
| PubChem CID | 115072814 |
| Molecular Formula | C14H14O3S |
| Molecular Weight | 262.33 g/mol |
| Exact Mass | 262.07 |
| IUPAC Name | ethyl 2-(3,7-dimethyl-1-benzothiophen-2-yl)-2-oxoacetate |
| SMILES | CCOC(=O)C(=O)c1sc2c(C)cccc2c1C |
| InChI | InChI=1S/C14H14O3S/c1-4-17-14(16)11(15)13-9(3)10-7-5-6-8(2)12(10)18-13/h5-7H,4H2,1-3H3 |
| InChIKey | BEKAOYLMTACMQK-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.33 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|