About ethyl 8-hydroxy-5-oxo-2,3-dihydro-1H-4,1-benzoxazepine-2-carboxylate
ethyl 8-hydroxy-5-oxo-2,3-dihydro-1H-4,1-benzoxazepine-2-carboxylate (PubChem CID 115073526) has the molecular formula C12H13NO5
and a molecular weight of 251.24 g/mol. Its IUPAC name is ethyl 8-hydroxy-5-oxo-2,3-dihydro-1H-4,1-benzoxazepine-2-carboxylate.
Molecular Properties
| Compound Name | ethyl 8-hydroxy-5-oxo-2,3-dihydro-1H-4,1-benzoxazepine-2-carboxylate |
| PubChem CID | 115073526 |
| Molecular Formula | C12H13NO5 |
| Molecular Weight | 251.24 g/mol |
| Exact Mass | 251.08 |
| IUPAC Name | ethyl 8-hydroxy-5-oxo-2,3-dihydro-1H-4,1-benzoxazepine-2-carboxylate |
| SMILES | CCOC(=O)C1COC(=O)c2ccc(O)cc2N1 |
| InChI | InChI=1S/C12H13NO5/c1-2-17-12(16)10-6-18-11(15)8-4-3-7(14)5-9(8)13-10/h3-5,10,13-14H,2,6H2,1H3 |
| InChIKey | HYEZZNOJJKEKOC-UHFFFAOYSA-N |
| XLogP | 0.91 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 251.24 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze ethyl 8-hydroxy-5-oxo-2,3-dihydro-1H-4,1-benzoxazepine-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 8-hydroxy-5-oxo-2,3-dihydro-1H-4,1-benzoxazepine-2-carboxylate?
The IUPAC name of ethyl 8-hydroxy-5-oxo-2,3-dihydro-1H-4,1-benzoxazepine-2-carboxylate (CID 115073526) is ethyl 8-hydroxy-5-oxo-2,3-dihydro-1H-4,1-benzoxazepine-2-carboxylate.
What is the SMILES notation for ethyl 8-hydroxy-5-oxo-2,3-dihydro-1H-4,1-benzoxazepine-2-carboxylate?
The canonical SMILES for ethyl 8-hydroxy-5-oxo-2,3-dihydro-1H-4,1-benzoxazepine-2-carboxylate is CCOC(=O)C1COC(=O)c2ccc(O)cc2N1.
What is the InChIKey of ethyl 8-hydroxy-5-oxo-2,3-dihydro-1H-4,1-benzoxazepine-2-carboxylate?
The InChIKey is HYEZZNOJJKEKOC-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H13NO5/c1-2-17-12(16)10-6-18-11(15)8-4-3-7(14)5-9(8)13-10/h3-5,10,13-14H,2,6H2,1H3.
What are the key properties of ethyl 8-hydroxy-5-oxo-2,3-dihydro-1H-4,1-benzoxazepine-2-carboxylate?
ethyl 8-hydroxy-5-oxo-2,3-dihydro-1H-4,1-benzoxazepine-2-carboxylate has a molecular weight of 251.24 g/mol, XLogP of 0.91, 2 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 8-hydroxy-5-oxo-2,3-dihydro-1H-4,1-benzoxazepine-2-carboxylate is sourced from PubChem (CID 115073526), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).