C16H24O4 — CID 11507424
2-[(1S,5S)-5-methoxy-3-(2,5,5-trimethyl-1,3-dioxan-2-yl)cyclopent-2-en-1-yl]prop-2-enal (PubChem CID 11507424) has the molecular formula C16H24O4 and a molecular weight of 280.36 g/mol. Its IUPAC name is 2-[(1S,5S)-5-methoxy-3-(2,5,5-trimethyl-1,3-dioxan-2-yl)cyclopent-2-en-1-yl]prop-2-enal.
| Compound Name | 2-[(1S,5S)-5-methoxy-3-(2,5,5-trimethyl-1,3-dioxan-2-yl)cyclopent-2-en-1-yl]prop-2-enal |
|---|---|
| PubChem CID | 11507424 |
| Molecular Formula | C16H24O4 |
| Molecular Weight | 280.36 g/mol |
| Exact Mass | 280.17 |
| IUPAC Name | 2-[(1S,5S)-5-methoxy-3-(2,5,5-trimethyl-1,3-dioxan-2-yl)cyclopent-2-en-1-yl]prop-2-enal |
| SMILES | C=C(C=O)[C@@H]1C=C(C2(C)OCC(C)(C)CO2)C[C@@H]1OC |
| InChI | InChI=1S/C16H24O4/c1-11(8-17)13-6-12(7-14(13)18-5)16(4)19-9-15(2,3)10-20-16/h6,8,13-14H,1,7,9-10H2,2-5H3/t13-,14-/m0/s1 |
| InChIKey | KURVKXVPPRIQOZ-KBPBESRZSA-N |
| XLogP | 2.49 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.36 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|