C12H17N3O3S — CID 11507472
(2E)-2-cyano-2-(3-ethyl-4-oxo-1,3-thiazolidin-2-ylidene)-N-(1-hydroxy-2-methylpropan-2-yl)acetamide (PubChem CID 11507472) has the molecular formula C12H17N3O3S and a molecular weight of 283.35 g/mol. Its IUPAC name is (2E)-2-cyano-2-(3-ethyl-4-oxo-1,3-thiazolidin-2-ylidene)-N-(1-hydroxy-2-methylpropan-2-yl)acetamide.
| Compound Name | (2E)-2-cyano-2-(3-ethyl-4-oxo-1,3-thiazolidin-2-ylidene)-N-(1-hydroxy-2-methylpropan-2-yl)acetamide |
|---|---|
| PubChem CID | 11507472 |
| Molecular Formula | C12H17N3O3S |
| Molecular Weight | 283.35 g/mol |
| Exact Mass | 283.10 |
| IUPAC Name | (2E)-2-cyano-2-(3-ethyl-4-oxo-1,3-thiazolidin-2-ylidene)-N-(1-hydroxy-2-methylpropan-2-yl)acetamide |
| SMILES | CCN1C(=O)CS/C1=C(\C#N)C(=O)NC(C)(C)CO |
| InChI | InChI=1S/C12H17N3O3S/c1-4-15-9(17)6-19-11(15)8(5-13)10(18)14-12(2,3)7-16/h16H,4,6-7H2,1-3H3,(H,14,18)/b11-8+ |
| InChIKey | QABXXQBUHYXLSN-DHZHZOJOSA-N |
| XLogP | 0.20 |
| TPSA | 93.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.35 |
| LogP ≤ 5 | 0.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|