C17H25NO — CID 115075527
7-(3,3-dimethylcyclohexyl)oxy-1,2,3,4-tetrahydroquinoline (PubChem CID 115075527) has the molecular formula C17H25NO and a molecular weight of 259.39 g/mol. Its IUPAC name is 7-(3,3-dimethylcyclohexyl)oxy-1,2,3,4-tetrahydroquinoline.
| Compound Name | 7-(3,3-dimethylcyclohexyl)oxy-1,2,3,4-tetrahydroquinoline |
|---|---|
| PubChem CID | 115075527 |
| Molecular Formula | C17H25NO |
| Molecular Weight | 259.39 g/mol |
| Exact Mass | 259.19 |
| IUPAC Name | 7-(3,3-dimethylcyclohexyl)oxy-1,2,3,4-tetrahydroquinoline |
| SMILES | CC1(C)CCCC(Oc2ccc3c(c2)NCCC3)C1 |
| InChI | InChI=1S/C17H25NO/c1-17(2)9-3-6-15(12-17)19-14-8-7-13-5-4-10-18-16(13)11-14/h7-8,11,15,18H,3-6,9-10,12H2,1-2H3 |
| InChIKey | YMGFLXKZLYHDFZ-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.39 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |