C14H19NOS — CID 115075868
4-(thian-4-ylmethoxy)-2,3-dihydro-1H-isoindole (PubChem CID 115075868) has the molecular formula C14H19NOS and a molecular weight of 249.38 g/mol. Its IUPAC name is 4-(thian-4-ylmethoxy)-2,3-dihydro-1H-isoindole.
| Compound Name | 4-(thian-4-ylmethoxy)-2,3-dihydro-1H-isoindole |
|---|---|
| PubChem CID | 115075868 |
| Molecular Formula | C14H19NOS |
| Molecular Weight | 249.38 g/mol |
| Exact Mass | 249.12 |
| IUPAC Name | 4-(thian-4-ylmethoxy)-2,3-dihydro-1H-isoindole |
| SMILES | c1cc2c(c(OCC3CCSCC3)c1)CNC2 |
| InChI | InChI=1S/C14H19NOS/c1-2-12-8-15-9-13(12)14(3-1)16-10-11-4-6-17-7-5-11/h1-3,11,15H,4-10H2 |
| InChIKey | SHCLCLUABADNFC-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.38 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |