About 3-(2,3-dihydro-1H-isoindol-5-yloxy)-3-methylthiolane 1,1-dioxide
3-(2,3-dihydro-1H-isoindol-5-yloxy)-3-methylthiolane 1,1-dioxide (PubChem CID 115075941) has the molecular formula C13H17NO3S
and a molecular weight of 267.35 g/mol. Its IUPAC name is 3-(2,3-dihydro-1H-isoindol-5-yloxy)-3-methylthiolane 1,1-dioxide.
Molecular Properties
| Compound Name | 3-(2,3-dihydro-1H-isoindol-5-yloxy)-3-methylthiolane 1,1-dioxide |
| PubChem CID | 115075941 |
| Molecular Formula | C13H17NO3S |
| Molecular Weight | 267.35 g/mol |
| Exact Mass | 267.09 |
| IUPAC Name | 3-(2,3-dihydro-1H-isoindol-5-yloxy)-3-methylthiolane 1,1-dioxide |
| SMILES | CC1(Oc2ccc3c(c2)CNC3)CCS(=O)(=O)C1 |
| InChI | InChI=1S/C13H17NO3S/c1-13(4-5-18(15,16)9-13)17-12-3-2-10-7-14-8-11(10)6-12/h2-3,6,14H,4-5,7-9H2,1H3 |
| InChIKey | QNYUOWDOMGUEEL-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 267.35 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-(2,3-dihydro-1H-isoindol-5-yloxy)-3-methylthiolane 1,1-dioxide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(2,3-dihydro-1H-isoindol-5-yloxy)-3-methylthiolane 1,1-dioxide?
The IUPAC name of 3-(2,3-dihydro-1H-isoindol-5-yloxy)-3-methylthiolane 1,1-dioxide (CID 115075941) is 3-(2,3-dihydro-1H-isoindol-5-yloxy)-3-methylthiolane 1,1-dioxide.
What is the SMILES notation for 3-(2,3-dihydro-1H-isoindol-5-yloxy)-3-methylthiolane 1,1-dioxide?
The canonical SMILES for 3-(2,3-dihydro-1H-isoindol-5-yloxy)-3-methylthiolane 1,1-dioxide is CC1(Oc2ccc3c(c2)CNC3)CCS(=O)(=O)C1.
What is the InChIKey of 3-(2,3-dihydro-1H-isoindol-5-yloxy)-3-methylthiolane 1,1-dioxide?
The InChIKey is QNYUOWDOMGUEEL-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H17NO3S/c1-13(4-5-18(15,16)9-13)17-12-3-2-10-7-14-8-11(10)6-12/h2-3,6,14H,4-5,7-9H2,1H3.
What are the key properties of 3-(2,3-dihydro-1H-isoindol-5-yloxy)-3-methylthiolane 1,1-dioxide?
3-(2,3-dihydro-1H-isoindol-5-yloxy)-3-methylthiolane 1,1-dioxide has a molecular weight of 267.35 g/mol, XLogP of 1.25, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(2,3-dihydro-1H-isoindol-5-yloxy)-3-methylthiolane 1,1-dioxide is sourced from PubChem (CID 115075941), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).