C9H15N3O2 — CID 115077951
5-(1-ethylpiperidin-2-yl)-1,2,4-oxadiazol-3-one (PubChem CID 115077951) has the molecular formula C9H15N3O2 and a molecular weight of 197.24 g/mol. Its IUPAC name is 5-(1-ethylpiperidin-2-yl)-1,2,4-oxadiazol-3-one.
| Compound Name | 5-(1-ethylpiperidin-2-yl)-1,2,4-oxadiazol-3-one |
|---|---|
| PubChem CID | 115077951 |
| Molecular Formula | C9H15N3O2 |
| Molecular Weight | 197.24 g/mol |
| Exact Mass | 197.12 |
| IUPAC Name | 5-(1-ethylpiperidin-2-yl)-1,2,4-oxadiazol-3-one |
| SMILES | CCN1CCCCC1c1nc(=O)[nH]o1 |
| InChI | InChI=1S/C9H15N3O2/c1-2-12-6-4-3-5-7(12)8-10-9(13)11-14-8/h7H,2-6H2,1H3,(H,11,13) |
| InChIKey | ATRPLBPOTYWNJS-UHFFFAOYSA-N |
| XLogP | 0.91 |
| TPSA | 62.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.24 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |