About 5-propyl-1,2,4-oxadiazole-3-carbaldehyde
5-propyl-1,2,4-oxadiazole-3-carbaldehyde (PubChem CID 115079136) has the molecular formula C6H8N2O2
and a molecular weight of 140.14 g/mol. Its IUPAC name is 5-propyl-1,2,4-oxadiazole-3-carbaldehyde.
Molecular Properties
| Compound Name | 5-propyl-1,2,4-oxadiazole-3-carbaldehyde |
| PubChem CID | 115079136 |
| Molecular Formula | C6H8N2O2 |
| Molecular Weight | 140.14 g/mol |
| Exact Mass | 140.06 |
| IUPAC Name | 5-propyl-1,2,4-oxadiazole-3-carbaldehyde |
| SMILES | CCCc1nc(C=O)no1 |
| InChI | InChI=1S/C6H8N2O2/c1-2-3-6-7-5(4-9)8-10-6/h4H,2-3H2,1H3 |
| InChIKey | ZYHCWBVXTWSJHE-UHFFFAOYSA-N |
| XLogP | 0.83 |
| TPSA | 55.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 140.14 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 5-propyl-1,2,4-oxadiazole-3-carbaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-propyl-1,2,4-oxadiazole-3-carbaldehyde?
The IUPAC name of 5-propyl-1,2,4-oxadiazole-3-carbaldehyde (CID 115079136) is 5-propyl-1,2,4-oxadiazole-3-carbaldehyde.
What is the SMILES notation for 5-propyl-1,2,4-oxadiazole-3-carbaldehyde?
The canonical SMILES for 5-propyl-1,2,4-oxadiazole-3-carbaldehyde is CCCc1nc(C=O)no1.
What is the InChIKey of 5-propyl-1,2,4-oxadiazole-3-carbaldehyde?
The InChIKey is ZYHCWBVXTWSJHE-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H8N2O2/c1-2-3-6-7-5(4-9)8-10-6/h4H,2-3H2,1H3.
What are the key properties of 5-propyl-1,2,4-oxadiazole-3-carbaldehyde?
5-propyl-1,2,4-oxadiazole-3-carbaldehyde has a molecular weight of 140.14 g/mol, XLogP of 0.83, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-propyl-1,2,4-oxadiazole-3-carbaldehyde is sourced from PubChem (CID 115079136), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).