C20H28O3 — CID 11507960
(1R,2S,6R,9R,11S,13R)-6,9,13-trimethyl-3-propan-2-yl-12-oxatetracyclo[7.6.0.02,6.011,13]pentadec-3-ene-5,7-dione (PubChem CID 11507960) has the molecular formula C20H28O3 and a molecular weight of 316.44 g/mol. Its IUPAC name is (1R,2S,6R,9R,11S,13R)-6,9,13-trimethyl-3-propan-2-yl-12-oxatetracyclo[7.6.0.02,6.011,13]pentadec-3-ene-5,7-dione.
| Compound Name | (1R,2S,6R,9R,11S,13R)-6,9,13-trimethyl-3-propan-2-yl-12-oxatetracyclo[7.6.0.02,6.011,13]pentadec-3-ene-5,7-dione |
|---|---|
| PubChem CID | 11507960 |
| Molecular Formula | C20H28O3 |
| Molecular Weight | 316.44 g/mol |
| Exact Mass | 316.20 |
| IUPAC Name | (1R,2S,6R,9R,11S,13R)-6,9,13-trimethyl-3-propan-2-yl-12-oxatetracyclo[7.6.0.02,6.011,13]pentadec-3-ene-5,7-dione |
| SMILES | CC(C)C1=CC(=O)[C@@]2(C)C(=O)C[C@@]3(C)C[C@@H]4O[C@]4(C)CC[C@@H]3[C@@H]12 |
| InChI | InChI=1S/C20H28O3/c1-11(2)12-8-14(21)20(5)15(22)9-18(3)10-16-19(4,23-16)7-6-13(18)17(12)20/h8,11,13,16-17H,6-7,9-10H2,1-5H3/t13-,16+,17-,18+,19-,20+/m1/s1 |
| InChIKey | SUPKTQPWTVSFQS-BHPSNQOYSA-N |
| XLogP | 3.71 |
| TPSA | 46.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.44 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|