3-[5-(thiophen-2-ylmethyl)-1,2,4-oxadiazol-3-yl]propanoic acid

C10H10N2O3S — CID 115079627

IUPAC3-[5-(thiophen-2-ylmethyl)-1,2,4-oxadiazol-3-yl]propanoic acid
SMILESO=C(O)CCc1noc(Cc2cccs2)n1
InChIInChI=1S/C10H10N2O3S/c13-10(14)4-3-8-11-9(15-12-8)6-7-2-1-5-16-7/h1-2,5H,3-4,6H2,(H,13,14)
InChIKeyUOZHOZIVEZPPLR-UHFFFAOYSA-N
MW238.27 g/mol
LogP1.74
Rot. Bonds5

About 3-[5-(thiophen-2-ylmethyl)-1,2,4-oxadiazol-3-yl]propanoic acid

3-[5-(thiophen-2-ylmethyl)-1,2,4-oxadiazol-3-yl]propanoic acid (PubChem CID 115079627) has the molecular formula C10H10N2O3S and a molecular weight of 238.27 g/mol. Its IUPAC name is 3-[5-(thiophen-2-ylmethyl)-1,2,4-oxadiazol-3-yl]propanoic acid.

Molecular Properties

Compound Name3-[5-(thiophen-2-ylmethyl)-1,2,4-oxadiazol-3-yl]propanoic acid
PubChem CID115079627
Molecular FormulaC10H10N2O3S
Molecular Weight238.27 g/mol
Exact Mass238.04
IUPAC Name3-[5-(thiophen-2-ylmethyl)-1,2,4-oxadiazol-3-yl]propanoic acid
SMILESO=C(O)CCc1noc(Cc2cccs2)n1
InChIInChI=1S/C10H10N2O3S/c13-10(14)4-3-8-11-9(15-12-8)6-7-2-1-5-16-7/h1-2,5H,3-4,6H2,(H,13,14)
InChIKeyUOZHOZIVEZPPLR-UHFFFAOYSA-N
XLogP1.74
TPSA76.22 Ų
H-Bond Donors1
H-Bond Acceptors5
Rotatable Bonds5
Heavy Atoms16
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500238.27
LogP ≤ 51.74
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 105

Analyze 3-[5-(thiophen-2-ylmethyl)-1,2,4-oxadiazol-3-yl]propanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-[5-(thiophen-2-ylmethyl)-1,2,4-oxadiazol-3-yl]propanoic acid?
The IUPAC name of 3-[5-(thiophen-2-ylmethyl)-1,2,4-oxadiazol-3-yl]propanoic acid (CID 115079627) is 3-[5-(thiophen-2-ylmethyl)-1,2,4-oxadiazol-3-yl]propanoic acid.
What is the SMILES notation for 3-[5-(thiophen-2-ylmethyl)-1,2,4-oxadiazol-3-yl]propanoic acid?
The canonical SMILES for 3-[5-(thiophen-2-ylmethyl)-1,2,4-oxadiazol-3-yl]propanoic acid is O=C(O)CCc1noc(Cc2cccs2)n1.
What is the InChIKey of 3-[5-(thiophen-2-ylmethyl)-1,2,4-oxadiazol-3-yl]propanoic acid?
The InChIKey is UOZHOZIVEZPPLR-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H10N2O3S/c13-10(14)4-3-8-11-9(15-12-8)6-7-2-1-5-16-7/h1-2,5H,3-4,6H2,(H,13,14).
What are the key properties of 3-[5-(thiophen-2-ylmethyl)-1,2,4-oxadiazol-3-yl]propanoic acid?
3-[5-(thiophen-2-ylmethyl)-1,2,4-oxadiazol-3-yl]propanoic acid has a molecular weight of 238.27 g/mol, XLogP of 1.74, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[5-(thiophen-2-ylmethyl)-1,2,4-oxadiazol-3-yl]propanoic acid is sourced from PubChem (CID 115079627), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).