About 2-(5-bromo-1,2,4-oxadiazol-3-yl)thiane 1,1-dioxide
2-(5-bromo-1,2,4-oxadiazol-3-yl)thiane 1,1-dioxide (PubChem CID 115079727) has the molecular formula C7H9BrN2O3S
and a molecular weight of 281.13 g/mol. Its IUPAC name is 2-(5-bromo-1,2,4-oxadiazol-3-yl)thiane 1,1-dioxide.
Molecular Properties
| Compound Name | 2-(5-bromo-1,2,4-oxadiazol-3-yl)thiane 1,1-dioxide |
| PubChem CID | 115079727 |
| Molecular Formula | C7H9BrN2O3S |
| Molecular Weight | 281.13 g/mol |
| Exact Mass | 279.95 |
| IUPAC Name | 2-(5-bromo-1,2,4-oxadiazol-3-yl)thiane 1,1-dioxide |
| SMILES | O=S1(=O)CCCCC1c1noc(Br)n1 |
| InChI | InChI=1S/C7H9BrN2O3S/c8-7-9-6(10-13-7)5-3-1-2-4-14(5,11)12/h5H,1-4H2 |
| InChIKey | WIXAVBWGGRVEFF-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 73.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 281.13 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-(5-bromo-1,2,4-oxadiazol-3-yl)thiane 1,1-dioxide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(5-bromo-1,2,4-oxadiazol-3-yl)thiane 1,1-dioxide?
The IUPAC name of 2-(5-bromo-1,2,4-oxadiazol-3-yl)thiane 1,1-dioxide (CID 115079727) is 2-(5-bromo-1,2,4-oxadiazol-3-yl)thiane 1,1-dioxide.
What is the SMILES notation for 2-(5-bromo-1,2,4-oxadiazol-3-yl)thiane 1,1-dioxide?
The canonical SMILES for 2-(5-bromo-1,2,4-oxadiazol-3-yl)thiane 1,1-dioxide is O=S1(=O)CCCCC1c1noc(Br)n1.
What is the InChIKey of 2-(5-bromo-1,2,4-oxadiazol-3-yl)thiane 1,1-dioxide?
The InChIKey is WIXAVBWGGRVEFF-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H9BrN2O3S/c8-7-9-6(10-13-7)5-3-1-2-4-14(5,11)12/h5H,1-4H2.
What are the key properties of 2-(5-bromo-1,2,4-oxadiazol-3-yl)thiane 1,1-dioxide?
2-(5-bromo-1,2,4-oxadiazol-3-yl)thiane 1,1-dioxide has a molecular weight of 281.13 g/mol, XLogP of 1.47, 1 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(5-bromo-1,2,4-oxadiazol-3-yl)thiane 1,1-dioxide is sourced from PubChem (CID 115079727), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).