C21H29NO2 — CID 11508157
2-amino-2-[2-[4-(4-butylphenyl)phenyl]ethyl]propane-1,3-diol (PubChem CID 11508157) has the molecular formula C21H29NO2 and a molecular weight of 327.47 g/mol. Its IUPAC name is 2-amino-2-[2-[4-(4-butylphenyl)phenyl]ethyl]propane-1,3-diol.
| Compound Name | 2-amino-2-[2-[4-(4-butylphenyl)phenyl]ethyl]propane-1,3-diol |
|---|---|
| PubChem CID | 11508157 |
| Molecular Formula | C21H29NO2 |
| Molecular Weight | 327.47 g/mol |
| Exact Mass | 327.22 |
| IUPAC Name | 2-amino-2-[2-[4-(4-butylphenyl)phenyl]ethyl]propane-1,3-diol |
| SMILES | CCCCc1ccc(-c2ccc(CCC(N)(CO)CO)cc2)cc1 |
| InChI | InChI=1S/C21H29NO2/c1-2-3-4-17-5-9-19(10-6-17)20-11-7-18(8-12-20)13-14-21(22,15-23)16-24/h5-12,23-24H,2-4,13-16,22H2,1H3 |
| InChIKey | OBGSQOPLYSOMQI-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.47 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |