About 1-[2-(2-methoxyethyl)-1,3-oxazol-4-yl]ethanone
1-[2-(2-methoxyethyl)-1,3-oxazol-4-yl]ethanone (PubChem CID 115081953) has the molecular formula C8H11NO3
and a molecular weight of 169.18 g/mol. Its IUPAC name is 1-[2-(2-methoxyethyl)-1,3-oxazol-4-yl]ethanone.
Molecular Properties
| Compound Name | 1-[2-(2-methoxyethyl)-1,3-oxazol-4-yl]ethanone |
| PubChem CID | 115081953 |
| Molecular Formula | C8H11NO3 |
| Molecular Weight | 169.18 g/mol |
| Exact Mass | 169.07 |
| IUPAC Name | 1-[2-(2-methoxyethyl)-1,3-oxazol-4-yl]ethanone |
| SMILES | COCCc1nc(C(C)=O)co1 |
| InChI | InChI=1S/C8H11NO3/c1-6(10)7-5-12-8(9-7)3-4-11-2/h5H,3-4H2,1-2H3 |
| InChIKey | GVJCXVJSMZZXBK-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 52.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 169.18 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-[2-(2-methoxyethyl)-1,3-oxazol-4-yl]ethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[2-(2-methoxyethyl)-1,3-oxazol-4-yl]ethanone?
The IUPAC name of 1-[2-(2-methoxyethyl)-1,3-oxazol-4-yl]ethanone (CID 115081953) is 1-[2-(2-methoxyethyl)-1,3-oxazol-4-yl]ethanone.
What is the SMILES notation for 1-[2-(2-methoxyethyl)-1,3-oxazol-4-yl]ethanone?
The canonical SMILES for 1-[2-(2-methoxyethyl)-1,3-oxazol-4-yl]ethanone is COCCc1nc(C(C)=O)co1.
What is the InChIKey of 1-[2-(2-methoxyethyl)-1,3-oxazol-4-yl]ethanone?
The InChIKey is GVJCXVJSMZZXBK-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H11NO3/c1-6(10)7-5-12-8(9-7)3-4-11-2/h5H,3-4H2,1-2H3.
What are the key properties of 1-[2-(2-methoxyethyl)-1,3-oxazol-4-yl]ethanone?
1-[2-(2-methoxyethyl)-1,3-oxazol-4-yl]ethanone has a molecular weight of 169.18 g/mol, XLogP of 1.07, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[2-(2-methoxyethyl)-1,3-oxazol-4-yl]ethanone is sourced from PubChem (CID 115081953), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).