C8H11NO3 — CID 115081953
1-[2-(2-methoxyethyl)-1,3-oxazol-4-yl]ethanone (PubChem CID 115081953) has the molecular formula C8H11NO3 and a molecular weight of 169.18 g/mol. Its IUPAC name is 1-[2-(2-methoxyethyl)-1,3-oxazol-4-yl]ethanone.
| Compound Name | 1-[2-(2-methoxyethyl)-1,3-oxazol-4-yl]ethanone |
|---|---|
| PubChem CID | 115081953 |
| Molecular Formula | C8H11NO3 |
| Molecular Weight | 169.18 g/mol |
| Exact Mass | 169.07 |
| IUPAC Name | 1-[2-(2-methoxyethyl)-1,3-oxazol-4-yl]ethanone |
| SMILES | COCCc1nc(C(C)=O)co1 |
| InChI | InChI=1S/C8H11NO3/c1-6(10)7-5-12-8(9-7)3-4-11-2/h5H,3-4H2,1-2H3 |
| InChIKey | GVJCXVJSMZZXBK-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 52.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 169.18 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |