C10H16N2OS — CID 115082953
1-[2-(thian-2-yl)-1,3-oxazol-4-yl]ethanamine (PubChem CID 115082953) has the molecular formula C10H16N2OS and a molecular weight of 212.32 g/mol. Its IUPAC name is 1-[2-(thian-2-yl)-1,3-oxazol-4-yl]ethanamine.
| Compound Name | 1-[2-(thian-2-yl)-1,3-oxazol-4-yl]ethanamine |
|---|---|
| PubChem CID | 115082953 |
| Molecular Formula | C10H16N2OS |
| Molecular Weight | 212.32 g/mol |
| Exact Mass | 212.10 |
| IUPAC Name | 1-[2-(thian-2-yl)-1,3-oxazol-4-yl]ethanamine |
| SMILES | CC(N)c1coc(C2CCCCS2)n1 |
| InChI | InChI=1S/C10H16N2OS/c1-7(11)8-6-13-10(12-8)9-4-2-3-5-14-9/h6-7,9H,2-5,11H2,1H3 |
| InChIKey | QBTFQBUSLLYITR-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 52.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.32 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |