C9H12N2O2 — CID 115083052
2-(pyrrolidin-2-ylmethyl)-1,3-oxazole-4-carbaldehyde (PubChem CID 115083052) has the molecular formula C9H12N2O2 and a molecular weight of 180.21 g/mol. Its IUPAC name is 2-(pyrrolidin-2-ylmethyl)-1,3-oxazole-4-carbaldehyde.
| Compound Name | 2-(pyrrolidin-2-ylmethyl)-1,3-oxazole-4-carbaldehyde |
|---|---|
| PubChem CID | 115083052 |
| Molecular Formula | C9H12N2O2 |
| Molecular Weight | 180.21 g/mol |
| Exact Mass | 180.09 |
| IUPAC Name | 2-(pyrrolidin-2-ylmethyl)-1,3-oxazole-4-carbaldehyde |
| SMILES | O=Cc1coc(CC2CCCN2)n1 |
| InChI | InChI=1S/C9H12N2O2/c12-5-8-6-13-9(11-8)4-7-2-1-3-10-7/h5-7,10H,1-4H2 |
| InChIKey | KSDTYWKTBOCYDB-UHFFFAOYSA-N |
| XLogP | 0.78 |
| TPSA | 55.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.21 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|