C10H13NO2S — CID 115083368
2-(thian-3-ylmethyl)-1,3-oxazole-4-carbaldehyde (PubChem CID 115083368) has the molecular formula C10H13NO2S and a molecular weight of 211.29 g/mol. Its IUPAC name is 2-(thian-3-ylmethyl)-1,3-oxazole-4-carbaldehyde.
| Compound Name | 2-(thian-3-ylmethyl)-1,3-oxazole-4-carbaldehyde |
|---|---|
| PubChem CID | 115083368 |
| Molecular Formula | C10H13NO2S |
| Molecular Weight | 211.29 g/mol |
| Exact Mass | 211.07 |
| IUPAC Name | 2-(thian-3-ylmethyl)-1,3-oxazole-4-carbaldehyde |
| SMILES | O=Cc1coc(CC2CCCSC2)n1 |
| InChI | InChI=1S/C10H13NO2S/c12-5-9-6-13-10(11-9)4-8-2-1-3-14-7-8/h5-6,8H,1-4,7H2 |
| InChIKey | MFZYAVYCKQUQFY-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 43.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.29 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|