About 2-(thian-3-ylmethyl)-1,3-oxazole-4-carbaldehyde
2-(thian-3-ylmethyl)-1,3-oxazole-4-carbaldehyde (PubChem CID 115083368) has the molecular formula C10H13NO2S
and a molecular weight of 211.29 g/mol. Its IUPAC name is 2-(thian-3-ylmethyl)-1,3-oxazole-4-carbaldehyde.
Molecular Properties
| Compound Name | 2-(thian-3-ylmethyl)-1,3-oxazole-4-carbaldehyde |
| PubChem CID | 115083368 |
| Molecular Formula | C10H13NO2S |
| Molecular Weight | 211.29 g/mol |
| Exact Mass | 211.07 |
| IUPAC Name | 2-(thian-3-ylmethyl)-1,3-oxazole-4-carbaldehyde |
| SMILES | O=Cc1coc(CC2CCCSC2)n1 |
| InChI | InChI=1S/C10H13NO2S/c12-5-9-6-13-10(11-9)4-8-2-1-3-14-7-8/h5-6,8H,1-4,7H2 |
| InChIKey | MFZYAVYCKQUQFY-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 43.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 211.29 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 2-(thian-3-ylmethyl)-1,3-oxazole-4-carbaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(thian-3-ylmethyl)-1,3-oxazole-4-carbaldehyde?
The IUPAC name of 2-(thian-3-ylmethyl)-1,3-oxazole-4-carbaldehyde (CID 115083368) is 2-(thian-3-ylmethyl)-1,3-oxazole-4-carbaldehyde.
What is the SMILES notation for 2-(thian-3-ylmethyl)-1,3-oxazole-4-carbaldehyde?
The canonical SMILES for 2-(thian-3-ylmethyl)-1,3-oxazole-4-carbaldehyde is O=Cc1coc(CC2CCCSC2)n1.
What is the InChIKey of 2-(thian-3-ylmethyl)-1,3-oxazole-4-carbaldehyde?
The InChIKey is MFZYAVYCKQUQFY-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H13NO2S/c12-5-9-6-13-10(11-9)4-8-2-1-3-14-7-8/h5-6,8H,1-4,7H2.
What are the key properties of 2-(thian-3-ylmethyl)-1,3-oxazole-4-carbaldehyde?
2-(thian-3-ylmethyl)-1,3-oxazole-4-carbaldehyde has a molecular weight of 211.29 g/mol, XLogP of 2.17, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(thian-3-ylmethyl)-1,3-oxazole-4-carbaldehyde is sourced from PubChem (CID 115083368), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).