About 2-(1H-phenanthro[9,10-d]imidazol-2-yl)benzene-1,3-dicarbonitrile
2-(1H-phenanthro[9,10-d]imidazol-2-yl)benzene-1,3-dicarbonitrile (PubChem CID 11508436) has the molecular formula C23H12N4
and a molecular weight of 344.38 g/mol. Its IUPAC name is 2-(1H-phenanthro[9,10-d]imidazol-2-yl)benzene-1,3-dicarbonitrile.
Molecular Properties
| Compound Name | 2-(1H-phenanthro[9,10-d]imidazol-2-yl)benzene-1,3-dicarbonitrile |
| PubChem CID | 11508436 |
| Molecular Formula | C23H12N4 |
| Molecular Weight | 344.38 g/mol |
| Exact Mass | 344.11 |
| IUPAC Name | 2-(1H-phenanthro[9,10-d]imidazol-2-yl)benzene-1,3-dicarbonitrile |
| SMILES | N#Cc1cccc(C#N)c1-c1nc2c3ccccc3c3ccccc3c2[nH]1 |
| InChI | InChI=1S/C23H12N4/c24-12-14-6-5-7-15(13-25)20(14)23-26-21-18-10-3-1-8-16(18)17-9-2-4-11-19(17)22(21)27-23/h1-11H,(H,26,27) |
| InChIKey | GWGRSXHVQFNJRE-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 76.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 344.38 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|
Analyze 2-(1H-phenanthro[9,10-d]imidazol-2-yl)benzene-1,3-dicarbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(1H-phenanthro[9,10-d]imidazol-2-yl)benzene-1,3-dicarbonitrile?
The IUPAC name of 2-(1H-phenanthro[9,10-d]imidazol-2-yl)benzene-1,3-dicarbonitrile (CID 11508436) is 2-(1H-phenanthro[9,10-d]imidazol-2-yl)benzene-1,3-dicarbonitrile.
What is the SMILES notation for 2-(1H-phenanthro[9,10-d]imidazol-2-yl)benzene-1,3-dicarbonitrile?
The canonical SMILES for 2-(1H-phenanthro[9,10-d]imidazol-2-yl)benzene-1,3-dicarbonitrile is N#Cc1cccc(C#N)c1-c1nc2c3ccccc3c3ccccc3c2[nH]1.
What is the InChIKey of 2-(1H-phenanthro[9,10-d]imidazol-2-yl)benzene-1,3-dicarbonitrile?
The InChIKey is GWGRSXHVQFNJRE-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H12N4/c24-12-14-6-5-7-15(13-25)20(14)23-26-21-18-10-3-1-8-16(18)17-9-2-4-11-19(17)22(21)27-23/h1-11H,(H,26,27).
What are the key properties of 2-(1H-phenanthro[9,10-d]imidazol-2-yl)benzene-1,3-dicarbonitrile?
2-(1H-phenanthro[9,10-d]imidazol-2-yl)benzene-1,3-dicarbonitrile has a molecular weight of 344.38 g/mol, XLogP of 5.28, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(1H-phenanthro[9,10-d]imidazol-2-yl)benzene-1,3-dicarbonitrile is sourced from PubChem (CID 11508436), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).