C12H18N4O8 — CID 11508473
3,6-bis(2,3-dihydroxypropylamino)pyrazine-2,5-dicarboxylic acid (PubChem CID 11508473) has the molecular formula C12H18N4O8 and a molecular weight of 346.30 g/mol. Its IUPAC name is 3,6-bis(2,3-dihydroxypropylamino)pyrazine-2,5-dicarboxylic acid.
| Compound Name | 3,6-bis(2,3-dihydroxypropylamino)pyrazine-2,5-dicarboxylic acid |
|---|---|
| PubChem CID | 11508473 |
| Molecular Formula | C12H18N4O8 |
| Molecular Weight | 346.30 g/mol |
| Exact Mass | 346.11 |
| IUPAC Name | 3,6-bis(2,3-dihydroxypropylamino)pyrazine-2,5-dicarboxylic acid |
| SMILES | O=C(O)c1nc(NCC(O)CO)c(C(=O)O)nc1NCC(O)CO |
| InChI | InChI=1S/C12H18N4O8/c17-3-5(19)1-13-9-7(11(21)22)16-10(8(15-9)12(23)24)14-2-6(20)4-18/h5-6,17-20H,1-4H2,(H,13,15)(H,14,16)(H,21,22)(H,23,24) |
| InChIKey | UMAWBLRKYRTSQN-UHFFFAOYSA-N |
| XLogP | -2.60 |
| TPSA | 205.36 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.30 |
| LogP ≤ 5 | -2.60 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 10 |