C11H17NO2S — CID 115085353
1-[2-(thian-4-ylmethyl)-1,3-oxazol-5-yl]ethanol (PubChem CID 115085353) has the molecular formula C11H17NO2S and a molecular weight of 227.33 g/mol. Its IUPAC name is 1-[2-(thian-4-ylmethyl)-1,3-oxazol-5-yl]ethanol.
| Compound Name | 1-[2-(thian-4-ylmethyl)-1,3-oxazol-5-yl]ethanol |
|---|---|
| PubChem CID | 115085353 |
| Molecular Formula | C11H17NO2S |
| Molecular Weight | 227.33 g/mol |
| Exact Mass | 227.10 |
| IUPAC Name | 1-[2-(thian-4-ylmethyl)-1,3-oxazol-5-yl]ethanol |
| SMILES | CC(O)c1cnc(CC2CCSCC2)o1 |
| InChI | InChI=1S/C11H17NO2S/c1-8(13)10-7-12-11(14-10)6-9-2-4-15-5-3-9/h7-9,13H,2-6H2,1H3 |
| InChIKey | NBGWDFZATVLANW-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 46.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.33 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |