C20H32N2O — CID 11508621
N,N-dimethyl-3-[[6-(pyrrolidin-1-ylmethyl)-5,6,7,8-tetrahydronaphthalen-2-yl]oxy]propan-1-amine (PubChem CID 11508621) has the molecular formula C20H32N2O and a molecular weight of 316.49 g/mol. Its IUPAC name is N,N-dimethyl-3-[[6-(pyrrolidin-1-ylmethyl)-5,6,7,8-tetrahydronaphthalen-2-yl]oxy]propan-1-amine.
| Compound Name | N,N-dimethyl-3-[[6-(pyrrolidin-1-ylmethyl)-5,6,7,8-tetrahydronaphthalen-2-yl]oxy]propan-1-amine |
|---|---|
| PubChem CID | 11508621 |
| Molecular Formula | C20H32N2O |
| Molecular Weight | 316.49 g/mol |
| Exact Mass | 316.25 |
| IUPAC Name | N,N-dimethyl-3-[[6-(pyrrolidin-1-ylmethyl)-5,6,7,8-tetrahydronaphthalen-2-yl]oxy]propan-1-amine |
| SMILES | CN(C)CCCOc1ccc2c(c1)CCC(CN1CCCC1)C2 |
| InChI | InChI=1S/C20H32N2O/c1-21(2)10-5-13-23-20-9-8-18-14-17(6-7-19(18)15-20)16-22-11-3-4-12-22/h8-9,15,17H,3-7,10-14,16H2,1-2H3 |
| InChIKey | MFIVQYPMHIWURF-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 15.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.49 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|