About 2-(5-methylthiophen-2-yl)-1,3-oxazole-5-carbaldehyde
2-(5-methylthiophen-2-yl)-1,3-oxazole-5-carbaldehyde (PubChem CID 115086456) has the molecular formula C9H7NO2S
and a molecular weight of 193.23 g/mol. Its IUPAC name is 2-(5-methylthiophen-2-yl)-1,3-oxazole-5-carbaldehyde.
Molecular Properties
| Compound Name | 2-(5-methylthiophen-2-yl)-1,3-oxazole-5-carbaldehyde |
| PubChem CID | 115086456 |
| Molecular Formula | C9H7NO2S |
| Molecular Weight | 193.23 g/mol |
| Exact Mass | 193.02 |
| IUPAC Name | 2-(5-methylthiophen-2-yl)-1,3-oxazole-5-carbaldehyde |
| SMILES | Cc1ccc(-c2ncc(C=O)o2)s1 |
| InChI | InChI=1S/C9H7NO2S/c1-6-2-3-8(13-6)9-10-4-7(5-11)12-9/h2-5H,1H3 |
| InChIKey | JHQHFGLRCYWCIU-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 43.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 193.23 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 2-(5-methylthiophen-2-yl)-1,3-oxazole-5-carbaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(5-methylthiophen-2-yl)-1,3-oxazole-5-carbaldehyde?
The IUPAC name of 2-(5-methylthiophen-2-yl)-1,3-oxazole-5-carbaldehyde (CID 115086456) is 2-(5-methylthiophen-2-yl)-1,3-oxazole-5-carbaldehyde.
What is the SMILES notation for 2-(5-methylthiophen-2-yl)-1,3-oxazole-5-carbaldehyde?
The canonical SMILES for 2-(5-methylthiophen-2-yl)-1,3-oxazole-5-carbaldehyde is Cc1ccc(-c2ncc(C=O)o2)s1.
What is the InChIKey of 2-(5-methylthiophen-2-yl)-1,3-oxazole-5-carbaldehyde?
The InChIKey is JHQHFGLRCYWCIU-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H7NO2S/c1-6-2-3-8(13-6)9-10-4-7(5-11)12-9/h2-5H,1H3.
What are the key properties of 2-(5-methylthiophen-2-yl)-1,3-oxazole-5-carbaldehyde?
2-(5-methylthiophen-2-yl)-1,3-oxazole-5-carbaldehyde has a molecular weight of 193.23 g/mol, XLogP of 2.52, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(5-methylthiophen-2-yl)-1,3-oxazole-5-carbaldehyde is sourced from PubChem (CID 115086456), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).