C12H11NO3 — CID 115087217
1-[2-(2-methoxyphenyl)-1,3-oxazol-5-yl]ethanone (PubChem CID 115087217) has the molecular formula C12H11NO3 and a molecular weight of 217.22 g/mol. Its IUPAC name is 1-[2-(2-methoxyphenyl)-1,3-oxazol-5-yl]ethanone.
| Compound Name | 1-[2-(2-methoxyphenyl)-1,3-oxazol-5-yl]ethanone |
|---|---|
| PubChem CID | 115087217 |
| Molecular Formula | C12H11NO3 |
| Molecular Weight | 217.22 g/mol |
| Exact Mass | 217.07 |
| IUPAC Name | 1-[2-(2-methoxyphenyl)-1,3-oxazol-5-yl]ethanone |
| SMILES | COc1ccccc1-c1ncc(C(C)=O)o1 |
| InChI | InChI=1S/C12H11NO3/c1-8(14)11-7-13-12(16-11)9-5-3-4-6-10(9)15-2/h3-7H,1-2H3 |
| InChIKey | KDTQBUBXMHMMRT-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 52.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.22 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |